Orotate

Orotic acid

Clinical data
AHFS/Drugs.com	International Drug Names
ATC code	none
Identifiers
IUPAC name 1,2,3,6-Tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid
CAS Number	65-86-1 Y
PubChem CID	967
IUPHAR/BPS	4690
DrugBank	DB02262 N
ChemSpider	942 N
UNII	61H4T033E5
KEGG	C00295 N
ECHA InfoCard	100.000.563
Chemical and physical data
Formula	C5H4N2O4
Molar mass	156.10 g/mol
3D model (Jmol)	Interactive image
SMILES O=C(O)\C1=C\C(=O)NC(=O)N1
InChI InChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11) N Key:PXQPEWDEAKTCGB-UHFFFAOYSA-N N
NY (what is this?)

Orotic acid is a heterocyclic compound and an acid; it is also known as pyrimidinecarboxylic acid. Historically it was believed to be part of the vitamin B complex and was called vitamin B₁₃, but it is now known that it is not a vitamin.

The compound is manufactured in the body via a mitochondrial enzyme, dihydroorotate dehydrogenase or a cytoplasmic enzyme of pyrimidine synthesis pathway. It is sometimes used as a mineral carrier in some dietary supplements (to increase their bioavailability), most commonly for lithium orotate.

Dihydroorotate is synthesized to orotic acid by the enzyme dihydroorotate dehydrogenase, where it later combines with phosphoribosyl pyrophosphate (PRPP) to form orotidine-5'-monophosphate (OMP). A distinguishing characteristic of pyrimidine synthesis is that the pyrimidine ring is fully synthesized before being attached to the ribose sugar, whereas purine synthesis happens by building the base directly on the sugar.

Orotic acid can be mutagenic in mammalian somatic cells. It is also mutagenic for bacteria and yeast.

A buildup of orotic acid can lead to orotic aciduria and acidemia. It may be a symptom of an increased ammonia load due to a metabolic disorder, such as a urea cycle disorder.