Hexahydroxydiphenoyl

Hexahydroxydiphenic acid

Names
Preferred IUPAC name 4,4',5,5',6,6'-Hexahydroxy[1,1'-biphenyl]-2,2'-dicarboxylic acid
Other names HHDP 3,4,5,3',4',5'-Hexahydroxydiphenate 3,4,5,3',4',5'-Hexahydroxydiphenic acid
Identifiers
3D model (JSmol)	Interactive image
ChemSpider	8490515 N
PubChem CID	10315050
InChI InChI=1S/C14H10O10/c15-5-1-3(13(21)22)7(11(19)9(5)17)8-4(14(23)24)2-6(16)10(18)12(8)20/h1-2,15-20H,(H,21,22)(H,23,24) N Key: MFTSECOLKFLUSD-UHFFFAOYSA-N N InChI=1/C14H10O10/c15-5-1-3(13(21)22)7(11(19)9(5)17)8-4(14(23)24)2-6(16)10(18)12(8)20/h1-2,15-20H,(H,21,22)(H,23,24) Key: MFTSECOLKFLUSD-UHFFFAOYAZ
SMILES O=C(O)c2cc(O)c(O)c(O)c2c1c(O)c(O)c(O)cc1C(=O)O
Properties
Chemical formula	C14H10O10
Molar mass	338.22 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N  (what is YN ?)
Infobox references

Hexahydroxydiphenic acid is a component of some ellagitannins such as casuarictin. Luteic acid is the lactone and ellagic acid is the dilactone of hexahydroxydiphenic acid.