Thelephoric acid

Thelephoric acid
Names


IUPAC name 2,3,8,9-Tetrahydroxybenzo[b][1]benzofuro[2,3-f][1]benzofuran-6,12-dione
Identifiers
3D model (JSmol)	Interactive image
ChemSpider	30776833
InChI InChI=1S/C18H8O8/c19-7-1-5-11(3-9(7)21)25-17-13(5)15(23)18-14(16(17)24)6-2-8(20)10(22)4-12(6)26-18/h1-4,19-22H Key: PDICCECAPKBDBB-UHFFFAOYSA-N InChI=1/C18H8O8/c19-7-1-5-11(3-9(7)21)25-17-13(5)15(23)18-14(16(17)24)6-2-8(20)10(22)4-12(6)26-18/h1-4,19-22H Key: PDICCECAPKBDBB-UHFFFAOYAC
SMILES c1c2c(cc(c1O)O)oc3c2C(=O)c4c(c5cc(c(cc5o4)O)O)C3=O
Properties
Chemical formula	C₁₈H₈O₈
Molar mass	352.25 g·mol⁻¹
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Thelephoric acid is a terphenylquinone pigment that is found in several fungi, such as Omphalotus subilludens and Polyozellus multiplex. Thelephoric acid has been shown to inhibit prolyl endopeptidase, an enzyme that has a role in processing proteins (specifically, amyloid precursor protein) in Alzheimer's disease. Chemicals that inhibit prolyl endopeptidase have attracted research interest due to their potential therapeutic effects. It is derived from atromentin, and its precusor can be from cyclovariegatin. Fragmentation patterns have suggested that polymers of thelephoric acid exists.