Strychnine sulfate

Strychnine

Names
Other names Strychnidin-10-one
Identifiers
CAS Number	57-24-9 (base) Y 60-41-3 (sulfate) Y
3D model (JSmol)	Interactive image
ChEBI	CHEBI:28973 Y
ChemSpider	389877 Y
ECHA InfoCard	100.000.290
IUPHAR/BPS	347
KEGG	C06522 Y
PubChem CID	441071
RTECS number	WL2275000
UNII	H9Y79VD43J Y
UN number	1692
InChI InChI=1S/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1 Y Key: QMGVPVSNSZLJIA-FVWCLLPLSA-N Y InChI=1/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1 Key: QMGVPVSNSZLJIA-FVWCLLPLBR
SMILES O=C7N2c1ccccc1[C@@]64[C@@H]2[C@@H]3[C@@H](OC/C=C5\[C@@H]3C[C@@H]6N(CC4)C5)C7
Properties
Chemical formula	C21H22N2O2
Molar mass	334.42 g·mol−1
Appearance	White or translucent crystal or crystalline powder; Bitter tasting
Odor	Odorless
Density	1.36 g cm−3
Melting point	543 K (270 °C)
Boiling point	557−559 K (284−286 °C)
Solubility in water	0.02% (20°C)
Acidity (pKa)	8.25
Hazards
Lethal dose or concentration (LD, LC):
LD50 (median dose)	0.5 mg/kg (dog, oral) 0.5 mg/kg (cat, oral) 2 mg/kg (mouse, oral) 16 mg/kg (rat, oral) 2.35 (rat, oral)
LDLo (lowest published)	0.6 mg/kg (rabbit, oral)
US health exposure limits (NIOSH):
PEL (Permissible)	TWA 0.15 mg/m3
REL (Recommended)	TWA 0.15 mg/m3
IDLH (Immediate danger)	3 mg/m3
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Y  (what is YN ?)
Infobox references

Strychnine (/ˈstrɪkniːn/ STRIK-neen; also US: /ˈstrɪknaɪn/ STRIK-nyne or /ˈstrɪknɪn/ STRIK-nin) is a highly toxic, colorless, bitter, crystalline alkaloid used as a pesticide, particularly for killing small vertebrates such as birds and rodents. Strychnine, when inhaled, swallowed, or absorbed through the eyes or mouth, causes poisoning which results in muscular convulsions and eventually death through asphyxia. While it has no known medicinal effects, in the past the convulsant effect was believed to be beneficial in small doses. The most common source is from the seeds of the Strychnos nux-vomica tree.