Rhodamine B

Rhodamine B

Names
IUPAC name [9-(2-carboxyphenyl)-6-diethylamino-3-xanthenylidene]-diethylammonium chloride
Other names Rhodamine 610, C.I. Pigment Violet 1, Basic Violet 10, C.I. 45170
Identifiers
CAS Number	81-88-9 Y
3D model (Jmol)	Interactive image
ChEBI	CHEBI:52334 Y
ChEMBL	ChEMBL428971 Y
ChemSpider	6439 Y
ECHA InfoCard	100.001.259
KEGG	C19517 N
PubChem	6694
InChI InChI=1S/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H,5-8H2,1-4H3;1H Y Key: PYWVYCXTNDRMGF-UHFFFAOYSA-N Y
SMILES CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-]
Properties
Chemical formula	C28H31ClN2O3
Molar mass	479.02
Appearance	red to violet powder
Melting point	210 to 211 °C (410 to 412 °F; 483 to 484 K) (Decomposes)
Solubility in water	~15 g/L (20 °C)
Hazards
Safety data sheet	MSDS
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N  (what is YN ?)
Infobox references

Rhodamine B /ˈroʊdəmiːn/ is a chemical compound and a dye. It is often used as a tracer dye within water to determine the rate and direction of flow and transport. Rhodamine dyes fluoresce and can thus be detected easily and inexpensively with instruments called fluorometers. Rhodamine dyes are used extensively in biotechnology applications such as fluorescence microscopy, flow cytometry, fluorescence correlation spectroscopy and ELISA.

Rhodamine B is used in biology as a staining fluorescent dye, sometimes in combination with auramine O, as the auramine-rhodamine stain to demonstrate acid-fast organisms, notably Mycobacterium.

Rhodamine B is tunable around 610 nm when used as a laser dye. Its luminescence quantum yield is 0.65 in basic ethanol, 0.49 in ethanol, 1.0, and 0.68 in 94% ethanol. The fluorescence yield is temperature dependent.

The solubility of rhodamine B in water is ~15 g/L. However, the solubility in acetic acid solution (30 vol.%) is ~400 g/L. Chlorinated tap water decomposes rhodamine B. Rhodamine B solutions adsorb to plastics and should be kept in glass.

Rhodamine B is being tested for use as a biomarker in oral rabies vaccines for wildlife, such as raccoons, to identify animals that have eaten a vaccine bait. The rhodamine is incorporated into the animal's whiskers and teeth.