Pyrrolidinylthiambutene

Pyrrolidinylthiambutene

Clinical data
ATC code	none
Identifiers
IUPAC name 1-(1-methyl-3,3-di-2-thienylprop-2-en-1-yl)pyrrolidine
CAS Number	785722-57-8
Chemical and physical data
Formula	C16H19NS2
Molar mass	289.458 g/mol
3D model (Jmol)	Interactive image
Melting point	167 to 169 °C (333 to 336 °F)
SMILES C2CCCN2C(C)C=C(c1sccc1)c3sccc3

Pyrrolidinylthiambutene is an opioid analgesic drug from the thiambutene family with around 3/4 of the potency of morphine. It would be considered an illegal controlled substance analogue in some countries such as the USA, Australia and New Zealand, but is legal in countries not possessing a controlled-substances-analog-act equivalent.