Polyozellin

Polyozellin

Names
IUPAC name 6,12-Diacetoxy-2,3,8,9-tetrahydroxybenzo[1,2-b;4,5-b']bisbenzofuran
Identifiers
CAS Number	197703-46-1 Y
3D model (Jmol)	Interactive image
ChemSpider	338925 N
PubChem CID	382514
InChI InChI=1S/C22H14O10/c1-7(23)29-19-17-9-3-11(25)13(27)5-15(9)32-22(17)20(30-8(2)24)18-10-4-12(26)14(28)6-16(10)31-21(18)19/h3-6,25-28H,1-2H3 N Key: CCNILPFRYYKQOP-UHFFFAOYSA-N N InChI=1/C22H14O10/c1-7(23)29-19-17-9-3-11(25)13(27)5-15(9)32-22(17)20(30-8(2)24)18-10-4-12(26)14(28)6-16(10)31-21(18)19/h3-6,25-28H,1-2H3 Key: CCNILPFRYYKQOP-UHFFFAOYAD
SMILES CC(=O)OC1=C2C(=C(C3=C1C4=CC(=C(C=C4O3)O)O)OC(=O)C)C5=CC(=C(C=C5O2)O)O
Properties
Chemical formula	C22H14O10
Molar mass	438.34 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N  (what is YN ?)
Infobox references

Polyozellin is a chemical which occurs in the mushroom Polyozellus multiplex. It inhibits prolyl endopeptidase, an enzyme that has a role in processing proteins (specifically, amyloid precursor protein) in Alzheimer's disease. Chemicals that inhibit prolyl endopeptidase have attracted research interest due to their potential therapeutic effects. Structurally related dibenzofuranyl derivatives of polyozellin are known as kynapcins.