Piperidylthiambutene

Piperidylthiambutene

Clinical data
ATC code	none
Identifiers
IUPAC name 1-(1-methyl-3,3-di-2-thienylprop-2-en-1-yl)piperidine
CAS Number	54160-31-5 Y
PubChem CID	3041503
ChemSpider	2304772
Chemical and physical data
Formula	C17H21NS2
Molar mass	303.485 g/mol
3D model (Jmol)	Interactive image
Melting point	188 to 189 °C (370 to 372 °F)
SMILES C1CCCCN1C(C)C=C(c3cccs3)c2sccc2
InChI InChI=1S/C17H21NS2/c1-14(18-9-3-2-4-10-18)13-15(16-7-5-11-19-16)17-8-6-12-20-17/h5-8,11-14H,2-4,9-10H2,1H3 Key:FQRWJLVMJCKSME-UHFFFAOYSA-N

Piperidylthiambutene (Piperidinohton) is an opioid analgesic drug from the thiambutene family, which has around the same potency as morphine. If sold / was obtained for the purpose of human consumption it could be considered a controlled substance analogue in some countries such as the USA, Australia and New Zealand, but is legal in the rest of the world.