![]() |
|
Names | |
---|---|
IUPAC name
(Z)-Octadec-9-en-1-ol
|
|
Other names
Octadecenol
cis-9-Octadecen-1-ol |
|
Identifiers | |
3D model (Jmol)
|
|
ChEBI | |
ChemSpider | |
ECHA InfoCard | 100.005.089 |
KEGG | |
PubChem CID
|
|
UNII | |
|
|
|
|
Properties | |
C18H36O | |
Molar mass | 268.478 g/mol |
Density | 0.845-0.855 g/cm3 |
Melting point | 13 to 19 °C (55 to 66 °F; 286 to 292 K) |
Boiling point | 330 to 360 °C (626 to 680 °F; 603 to 633 K) |
Insoluble | |
Hazards | |
NFPA 704 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
|
![]() ![]() ![]() |
|
Infobox references | |
Oleyl alcohol, octadecenol, or cis-9-octadecen-1-ol, is an unsaturated fatty alcohol with the chemical formula C18H36O or CH3(CH2)7-CH=CH-(CH2)8OH.
It can be produced by the hydrogenation of oleic acid esters; which can be obtained naturally from beef fat, fish oil and in particular olive oil (from which it gains its name).
It has uses as a nonionic surfactant, emulsifier, emollient and thickener in skin creams, lotions and many other cosmetic products including shampoos and hair conditioners. It has also been investigated as a carrier for delivering medications through the skin or mucus membranes; particularly the lungs.