Dehydrohexahydroxydiphenic acid

Dehydrohexahydroxydiphenic acid

Names
IUPAC name 5,6,9,13,13-pentahydroxy-10-oxo-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-3,12-dicarboxylic acid
Other names Dehydrohexahydroxydiphenoyl DHHDP
Identifiers
3D model (JSmol)	Interactive image
SMILES O=C(O)c2cc(O)c(O)c1OC3(O)C(=O)C=C(C(c12)C3(O)O)C(=O)O
Properties
Chemical formula	C14H10O11
Molar mass	354.22 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Dehydrohexahydroxydiphenic acid is a group found in dehydroellagitannins. It is formed from hexahydroxydiphenic acid (HHDP) through oxidation of the plant hydrolysable tannins. It is found in ellagitannins such as euphorbin A, geraniin or mallotusinic acid.

In geraniin, it is forming an equilibrium mixture of six-membered hemi-ketal and five-membered hemi-ketal forms.