Saccharic acid

Saccharic acid

Names
IUPAC name D-glucaric acid
Other names (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid
Identifiers
CAS Number	87-73-0 N
3D model (Jmol)	Interactive image
ChEBI	CHEBI:16002 Y
ChemSpider	30577 Y
ECHA InfoCard	100.001.608
PubChem	33037
InChI InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1 Y Key: DSLZVSRJTYRBFB-LLEIAEIESA-N Y InChI=1/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1 Key: DSLZVSRJTYRBFB-LLEIAEIEBD
SMILES O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O
Properties
Chemical formula	C6H10O8
Molar mass	210.1388
Melting point	125-126 °C (decomposes)
Solubility in water	Well soluble in water
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N  (what is YN ?)
Infobox references

Saccharic acid, also called glucaric acid, is a chemical compound with the formula C₆H₁₀O₈. It is derived by oxidizing a sugar such as glucose with nitric acid.

The salts of saccharic acid are called saccharates or glucarates.